C19H23FN6O2 — CID 146028328
[3-fluoro-2-[4-(2-methylphenyl)piperazin-1-yl]-4-pyridinyl]methyl N-(diaminomethylidene)carbamate (PubChem CID 146028328) has the molecular formula C19H23FN6O2 and a molecular weight of 386.43 g/mol. Its IUPAC name is [3-fluoro-2-[4-(2-methylphenyl)piperazin-1-yl]-4-pyridinyl]methyl N-(diaminomethylidene)carbamate.
| Compound Name | [3-fluoro-2-[4-(2-methylphenyl)piperazin-1-yl]-4-pyridinyl]methyl N-(diaminomethylidene)carbamate |
|---|---|
| PubChem CID | 146028328 |
| Molecular Formula | C19H23FN6O2 |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | [3-fluoro-2-[4-(2-methylphenyl)piperazin-1-yl]-4-pyridinyl]methyl N-(diaminomethylidene)carbamate |
| SMILES | Cc1ccccc1N1CCN(c2nccc(COC(=O)N=C(N)N)c2F)CC1 |
| InChI | InChI=1S/C19H23FN6O2/c1-13-4-2-3-5-15(13)25-8-10-26(11-9-25)17-16(20)14(6-7-23-17)12-28-19(27)24-18(21)22/h2-7H,8-12H2,1H3,(H4,21,22,24,27) |
| InChIKey | WZIIPDQYFHSJKN-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 110.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|