C18H20FN5O4 — CID 129046018
[2-fluoro-3-[3-[(2-oxo-1H-pyridin-4-yl)methoxy]azetidin-1-yl]phenyl]methyl N-(diaminomethylidene)carbamate (PubChem CID 129046018) has the molecular formula C18H20FN5O4 and a molecular weight of 389.39 g/mol. Its IUPAC name is [2-fluoro-3-[3-[(2-oxo-1H-pyridin-4-yl)methoxy]azetidin-1-yl]phenyl]methyl N-(diaminomethylidene)carbamate.
| Compound Name | [2-fluoro-3-[3-[(2-oxo-1H-pyridin-4-yl)methoxy]azetidin-1-yl]phenyl]methyl N-(diaminomethylidene)carbamate |
|---|---|
| PubChem CID | 129046018 |
| Molecular Formula | C18H20FN5O4 |
| Molecular Weight | 389.39 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | [2-fluoro-3-[3-[(2-oxo-1H-pyridin-4-yl)methoxy]azetidin-1-yl]phenyl]methyl N-(diaminomethylidene)carbamate |
| SMILES | NC(N)=NC(=O)OCc1cccc(N2CC(OCc3cc[nH]c(=O)c3)C2)c1F |
| InChI | InChI=1S/C18H20FN5O4/c19-16-12(10-28-18(26)23-17(20)21)2-1-3-14(16)24-7-13(8-24)27-9-11-4-5-22-15(25)6-11/h1-6,13H,7-10H2,(H,22,25)(H4,20,21,23,26) |
| InChIKey | RWNCKXDSSWUTIP-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 136.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.39 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|