C25H30FN7O2 — CID 160921699
[2-fluoro-3-[2-[4-(3-methyl-2-pyridinyl)piperazin-1-yl]pyrimidin-5-yl]phenyl]methyl 3-amino-3-iminopropanoate;methane (PubChem CID 160921699) has the molecular formula C25H30FN7O2 and a molecular weight of 479.56 g/mol. Its IUPAC name is [2-fluoro-3-[2-[4-(3-methyl-2-pyridinyl)piperazin-1-yl]pyrimidin-5-yl]phenyl]methyl 3-amino-3-iminopropanoate;methane.
| Compound Name | [2-fluoro-3-[2-[4-(3-methyl-2-pyridinyl)piperazin-1-yl]pyrimidin-5-yl]phenyl]methyl 3-amino-3-iminopropanoate;methane |
|---|---|
| PubChem CID | 160921699 |
| Molecular Formula | C25H30FN7O2 |
| Molecular Weight | 479.56 g/mol |
| Exact Mass | 479.24 |
| IUPAC Name | [2-fluoro-3-[2-[4-(3-methyl-2-pyridinyl)piperazin-1-yl]pyrimidin-5-yl]phenyl]methyl 3-amino-3-iminopropanoate;methane |
| SMILES | C.[H]/N=C(\N)CC(=O)OCc1cccc(-c2cnc(N3CCN(c4ncccc4C)CC3)nc2)c1F |
| InChI | InChI=1S/C24H26FN7O2.CH4/c1-16-4-3-7-28-23(16)31-8-10-32(11-9-31)24-29-13-18(14-30-24)19-6-2-5-17(22(19)25)15-34-21(33)12-20(26)27;/h2-7,13-14H,8-12,15H2,1H3,(H3,26,27);1H4 |
| InChIKey | SSCRQVDIBSAJFJ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 121.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.56 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|