C22H26FN5O5 — CID 158739868
methyl 4-[[5-[3-[(3-amino-3-iminopropanoyl)oxymethyl]-2-fluorophenyl]pyrimidin-2-yl]oxymethyl]piperidine-1-carboxylate (PubChem CID 158739868) has the molecular formula C22H26FN5O5 and a molecular weight of 459.48 g/mol. Its IUPAC name is methyl 4-[[5-[3-[(3-amino-3-iminopropanoyl)oxymethyl]-2-fluorophenyl]pyrimidin-2-yl]oxymethyl]piperidine-1-carboxylate.
| Compound Name | methyl 4-[[5-[3-[(3-amino-3-iminopropanoyl)oxymethyl]-2-fluorophenyl]pyrimidin-2-yl]oxymethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 158739868 |
| Molecular Formula | C22H26FN5O5 |
| Molecular Weight | 459.48 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | methyl 4-[[5-[3-[(3-amino-3-iminopropanoyl)oxymethyl]-2-fluorophenyl]pyrimidin-2-yl]oxymethyl]piperidine-1-carboxylate |
| SMILES | [H]/N=C(\N)CC(=O)OCc1cccc(-c2cnc(OCC3CCN(C(=O)OC)CC3)nc2)c1F |
| InChI | InChI=1S/C22H26FN5O5/c1-31-22(30)28-7-5-14(6-8-28)12-33-21-26-10-16(11-27-21)17-4-2-3-15(20(17)23)13-32-19(29)9-18(24)25/h2-4,10-11,14H,5-9,12-13H2,1H3,(H3,24,25) |
| InChIKey | IMDRDABAWUSFFU-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 140.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.48 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|