C23H28FN5O5S — CID 159838489
[3-[2-[(1-cyclopropylsulfonylpiperidin-4-yl)methoxy]pyrimidin-5-yl]-2-fluorophenyl]methyl 3-amino-3-iminopropanoate (PubChem CID 159838489) has the molecular formula C23H28FN5O5S and a molecular weight of 505.57 g/mol. Its IUPAC name is [3-[2-[(1-cyclopropylsulfonylpiperidin-4-yl)methoxy]pyrimidin-5-yl]-2-fluorophenyl]methyl 3-amino-3-iminopropanoate.
| Compound Name | [3-[2-[(1-cyclopropylsulfonylpiperidin-4-yl)methoxy]pyrimidin-5-yl]-2-fluorophenyl]methyl 3-amino-3-iminopropanoate |
|---|---|
| PubChem CID | 159838489 |
| Molecular Formula | C23H28FN5O5S |
| Molecular Weight | 505.57 g/mol |
| Exact Mass | 505.18 |
| IUPAC Name | [3-[2-[(1-cyclopropylsulfonylpiperidin-4-yl)methoxy]pyrimidin-5-yl]-2-fluorophenyl]methyl 3-amino-3-iminopropanoate |
| SMILES | [H]/N=C(\N)CC(=O)OCc1cccc(-c2cnc(OCC3CCN(S(=O)(=O)C4CC4)CC3)nc2)c1F |
| InChI | InChI=1S/C23H28FN5O5S/c24-22-16(14-33-21(30)10-20(25)26)2-1-3-19(22)17-11-27-23(28-12-17)34-13-15-6-8-29(9-7-15)35(31,32)18-4-5-18/h1-3,11-12,15,18H,4-10,13-14H2,(H3,25,26) |
| InChIKey | NOJOZSCLOGBVCV-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 148.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.57 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|