C23H30FN5O4 — CID 159593572
[2-fluoro-3-[2-(1-propanoylpiperidin-4-yl)oxypyrimidin-5-yl]phenyl]methyl 3-amino-3-iminopropanoate;methane (PubChem CID 159593572) has the molecular formula C23H30FN5O4 and a molecular weight of 459.52 g/mol. Its IUPAC name is [2-fluoro-3-[2-(1-propanoylpiperidin-4-yl)oxypyrimidin-5-yl]phenyl]methyl 3-amino-3-iminopropanoate;methane.
| Compound Name | [2-fluoro-3-[2-(1-propanoylpiperidin-4-yl)oxypyrimidin-5-yl]phenyl]methyl 3-amino-3-iminopropanoate;methane |
|---|---|
| PubChem CID | 159593572 |
| Molecular Formula | C23H30FN5O4 |
| Molecular Weight | 459.52 g/mol |
| Exact Mass | 459.23 |
| IUPAC Name | [2-fluoro-3-[2-(1-propanoylpiperidin-4-yl)oxypyrimidin-5-yl]phenyl]methyl 3-amino-3-iminopropanoate;methane |
| SMILES | C.[H]/N=C(\N)CC(=O)OCc1cccc(-c2cnc(OC3CCN(C(=O)CC)CC3)nc2)c1F |
| InChI | InChI=1S/C22H26FN5O4.CH4/c1-2-19(29)28-8-6-16(7-9-28)32-22-26-11-15(12-27-22)17-5-3-4-14(21(17)23)13-31-20(30)10-18(24)25;/h3-5,11-12,16H,2,6-10,13H2,1H3,(H3,24,25);1H4 |
| InChIKey | MKNSSWKWMGBZHW-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 131.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.52 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|