C19H19F2N5O3 — CID 160918446
[2-fluoro-3-[5-fluoro-6-(3-methoxyiminoazetidin-1-yl)-3-pyridinyl]phenyl]methyl 3-amino-3-iminopropanoate (PubChem CID 160918446) has the molecular formula C19H19F2N5O3 and a molecular weight of 403.39 g/mol. Its IUPAC name is [2-fluoro-3-[5-fluoro-6-(3-methoxyiminoazetidin-1-yl)-3-pyridinyl]phenyl]methyl 3-amino-3-iminopropanoate.
| Compound Name | [2-fluoro-3-[5-fluoro-6-(3-methoxyiminoazetidin-1-yl)-3-pyridinyl]phenyl]methyl 3-amino-3-iminopropanoate |
|---|---|
| PubChem CID | 160918446 |
| Molecular Formula | C19H19F2N5O3 |
| Molecular Weight | 403.39 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | [2-fluoro-3-[5-fluoro-6-(3-methoxyiminoazetidin-1-yl)-3-pyridinyl]phenyl]methyl 3-amino-3-iminopropanoate |
| SMILES | [H]/N=C(\N)CC(=O)OCc1cccc(-c2cnc(N3CC(=NOC)C3)c(F)c2)c1F |
| InChI | InChI=1S/C19H19F2N5O3/c1-28-25-13-8-26(9-13)19-15(20)5-12(7-24-19)14-4-2-3-11(18(14)21)10-29-17(27)6-16(22)23/h2-5,7H,6,8-10H2,1H3,(H3,22,23) |
| InChIKey | SVATTXZBDYDAMN-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 113.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.39 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|