C16H15F2N3O2 — CID 134584914
[2-fluoro-3-[5-fluoro-6-[3-(trideuteriomethoxyimino)azetidin-1-yl]-3-pyridinyl]phenyl]methanol (PubChem CID 134584914) has the molecular formula C16H15F2N3O2 and a molecular weight of 322.33 g/mol. Its IUPAC name is [2-fluoro-3-[5-fluoro-6-[3-(trideuteriomethoxyimino)azetidin-1-yl]-3-pyridinyl]phenyl]methanol.
| Compound Name | [2-fluoro-3-[5-fluoro-6-[3-(trideuteriomethoxyimino)azetidin-1-yl]-3-pyridinyl]phenyl]methanol |
|---|---|
| PubChem CID | 134584914 |
| Molecular Formula | C16H15F2N3O2 |
| Molecular Weight | 322.33 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | [2-fluoro-3-[5-fluoro-6-[3-(trideuteriomethoxyimino)azetidin-1-yl]-3-pyridinyl]phenyl]methanol |
| SMILES | [2H]C([2H])([2H])ON=C1CN(c2ncc(-c3cccc(CO)c3F)cc2F)C1 |
| InChI | InChI=1S/C16H15F2N3O2/c1-23-20-12-7-21(8-12)16-14(17)5-11(6-19-16)13-4-2-3-10(9-22)15(13)18/h2-6,22H,7-9H2,1H3/i1D3 |
| InChIKey | QFCSPAYECGBBKH-FIBGUPNXSA-N |
| XLogP | 2.34 |
| TPSA | 57.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.33 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|