C18H20F2N2O2 — CID 135200633
[2-fluoro-3-[5-fluoro-6-(3-propoxyazetidin-1-yl)-3-pyridinyl]phenyl]methanol (PubChem CID 135200633) has the molecular formula C18H20F2N2O2 and a molecular weight of 334.37 g/mol. Its IUPAC name is [2-fluoro-3-[5-fluoro-6-(3-propoxyazetidin-1-yl)-3-pyridinyl]phenyl]methanol.
| Compound Name | [2-fluoro-3-[5-fluoro-6-(3-propoxyazetidin-1-yl)-3-pyridinyl]phenyl]methanol |
|---|---|
| PubChem CID | 135200633 |
| Molecular Formula | C18H20F2N2O2 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | [2-fluoro-3-[5-fluoro-6-(3-propoxyazetidin-1-yl)-3-pyridinyl]phenyl]methanol |
| SMILES | CCCOC1CN(c2ncc(-c3cccc(CO)c3F)cc2F)C1 |
| InChI | InChI=1S/C18H20F2N2O2/c1-2-6-24-14-9-22(10-14)18-16(19)7-13(8-21-18)15-5-3-4-12(11-23)17(15)20/h3-5,7-8,14,23H,2,6,9-11H2,1H3 |
| InChIKey | SSEDDIBZZAAXRM-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |