C18H20FN3O4 — CID 121258785
2-[1-[5-[2-fluoro-3-(hydroxymethyl)phenyl]pyrimidin-2-yl]piperidin-4-yl]oxyacetic acid (PubChem CID 121258785) has the molecular formula C18H20FN3O4 and a molecular weight of 361.37 g/mol. Its IUPAC name is 2-[1-[5-[2-fluoro-3-(hydroxymethyl)phenyl]pyrimidin-2-yl]piperidin-4-yl]oxyacetic acid.
| Compound Name | 2-[1-[5-[2-fluoro-3-(hydroxymethyl)phenyl]pyrimidin-2-yl]piperidin-4-yl]oxyacetic acid |
|---|---|
| PubChem CID | 121258785 |
| Molecular Formula | C18H20FN3O4 |
| Molecular Weight | 361.37 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | 2-[1-[5-[2-fluoro-3-(hydroxymethyl)phenyl]pyrimidin-2-yl]piperidin-4-yl]oxyacetic acid |
| SMILES | O=C(O)COC1CCN(c2ncc(-c3cccc(CO)c3F)cn2)CC1 |
| InChI | InChI=1S/C18H20FN3O4/c19-17-12(10-23)2-1-3-15(17)13-8-20-18(21-9-13)22-6-4-14(5-7-22)26-11-16(24)25/h1-3,8-9,14,23H,4-7,10-11H2,(H,24,25) |
| InChIKey | YQZPWLSVQMDDFY-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 95.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.37 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |