C19H19FN4O4 — CID 126562146
5-[[[1-[5-[2-fluoro-3-(hydroxymethyl)phenyl]pyrimidin-2-yl]azetidin-3-ylidene]amino]oxymethyl]oxolan-2-one (PubChem CID 126562146) has the molecular formula C19H19FN4O4 and a molecular weight of 386.38 g/mol. Its IUPAC name is 5-[[[1-[5-[2-fluoro-3-(hydroxymethyl)phenyl]pyrimidin-2-yl]azetidin-3-ylidene]amino]oxymethyl]oxolan-2-one.
| Compound Name | 5-[[[1-[5-[2-fluoro-3-(hydroxymethyl)phenyl]pyrimidin-2-yl]azetidin-3-ylidene]amino]oxymethyl]oxolan-2-one |
|---|---|
| PubChem CID | 126562146 |
| Molecular Formula | C19H19FN4O4 |
| Molecular Weight | 386.38 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 5-[[[1-[5-[2-fluoro-3-(hydroxymethyl)phenyl]pyrimidin-2-yl]azetidin-3-ylidene]amino]oxymethyl]oxolan-2-one |
| SMILES | O=C1CCC(CON=C2CN(c3ncc(-c4cccc(CO)c4F)cn3)C2)O1 |
| InChI | InChI=1S/C19H19FN4O4/c20-18-12(10-25)2-1-3-16(18)13-6-21-19(22-7-13)24-8-14(9-24)23-27-11-15-4-5-17(26)28-15/h1-3,6-7,15,25H,4-5,8-11H2 |
| InChIKey | OLKRKRCYYQFGCA-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 97.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.38 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|