C23H29FN4O5 — CID 126562913
[2-fluoro-3-[2-[3-[2-[2-(oxan-2-yloxy)ethoxy]ethoxyimino]azetidin-1-yl]pyrimidin-5-yl]phenyl]methanol (PubChem CID 126562913) has the molecular formula C23H29FN4O5 and a molecular weight of 460.51 g/mol. Its IUPAC name is [2-fluoro-3-[2-[3-[2-[2-(oxan-2-yloxy)ethoxy]ethoxyimino]azetidin-1-yl]pyrimidin-5-yl]phenyl]methanol.
| Compound Name | [2-fluoro-3-[2-[3-[2-[2-(oxan-2-yloxy)ethoxy]ethoxyimino]azetidin-1-yl]pyrimidin-5-yl]phenyl]methanol |
|---|---|
| PubChem CID | 126562913 |
| Molecular Formula | C23H29FN4O5 |
| Molecular Weight | 460.51 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | [2-fluoro-3-[2-[3-[2-[2-(oxan-2-yloxy)ethoxy]ethoxyimino]azetidin-1-yl]pyrimidin-5-yl]phenyl]methanol |
| SMILES | OCc1cccc(-c2cnc(N3CC(=NOCCOCCOC4CCCCO4)C3)nc2)c1F |
| InChI | InChI=1S/C23H29FN4O5/c24-22-17(16-29)4-3-5-20(22)18-12-25-23(26-13-18)28-14-19(15-28)27-33-11-9-30-8-10-32-21-6-1-2-7-31-21/h3-5,12-13,21,29H,1-2,6-11,14-16H2 |
| InChIKey | DGBNDFDYUABBQA-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 98.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.51 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|