C16H16FN3O2 — CID 126562974
1-[5-[2-fluoro-3-(hydroxymethyl)phenyl]pyrimidin-2-yl]piperidin-4-one (PubChem CID 126562974) has the molecular formula C16H16FN3O2 and a molecular weight of 301.32 g/mol. Its IUPAC name is 1-[5-[2-fluoro-3-(hydroxymethyl)phenyl]pyrimidin-2-yl]piperidin-4-one.
| Compound Name | 1-[5-[2-fluoro-3-(hydroxymethyl)phenyl]pyrimidin-2-yl]piperidin-4-one |
|---|---|
| PubChem CID | 126562974 |
| Molecular Formula | C16H16FN3O2 |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 1-[5-[2-fluoro-3-(hydroxymethyl)phenyl]pyrimidin-2-yl]piperidin-4-one |
| SMILES | O=C1CCN(c2ncc(-c3cccc(CO)c3F)cn2)CC1 |
| InChI | InChI=1S/C16H16FN3O2/c17-15-11(10-21)2-1-3-14(15)12-8-18-16(19-9-12)20-6-4-13(22)5-7-20/h1-3,8-9,21H,4-7,10H2 |
| InChIKey | KKZUCBGFZFMKRD-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |