C20H19FN6O2 — CID 126562987
[2-fluoro-3-[2-(4-pyrimidin-2-yloxyiminopiperidin-1-yl)pyrimidin-5-yl]phenyl]methanol (PubChem CID 126562987) has the molecular formula C20H19FN6O2 and a molecular weight of 394.41 g/mol. Its IUPAC name is [2-fluoro-3-[2-(4-pyrimidin-2-yloxyiminopiperidin-1-yl)pyrimidin-5-yl]phenyl]methanol.
| Compound Name | [2-fluoro-3-[2-(4-pyrimidin-2-yloxyiminopiperidin-1-yl)pyrimidin-5-yl]phenyl]methanol |
|---|---|
| PubChem CID | 126562987 |
| Molecular Formula | C20H19FN6O2 |
| Molecular Weight | 394.41 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | [2-fluoro-3-[2-(4-pyrimidin-2-yloxyiminopiperidin-1-yl)pyrimidin-5-yl]phenyl]methanol |
| SMILES | OCc1cccc(-c2cnc(N3CCC(=NOc4ncccn4)CC3)nc2)c1F |
| InChI | InChI=1S/C20H19FN6O2/c21-18-14(13-28)3-1-4-17(18)15-11-24-19(25-12-15)27-9-5-16(6-10-27)26-29-20-22-7-2-8-23-20/h1-4,7-8,11-12,28H,5-6,9-10,13H2 |
| InChIKey | JIUPJRMCXLCAAP-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 96.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.41 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|