C25H35FN4O3Si — CID 159098232
1-[[1-[5-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-fluorophenyl]pyrimidin-2-yl]azetidin-3-ylidene]amino]oxypentan-3-one (PubChem CID 159098232) has the molecular formula C25H35FN4O3Si and a molecular weight of 486.66 g/mol. Its IUPAC name is 1-[[1-[5-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-fluorophenyl]pyrimidin-2-yl]azetidin-3-ylidene]amino]oxypentan-3-one.
| Compound Name | 1-[[1-[5-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-fluorophenyl]pyrimidin-2-yl]azetidin-3-ylidene]amino]oxypentan-3-one |
|---|---|
| PubChem CID | 159098232 |
| Molecular Formula | C25H35FN4O3Si |
| Molecular Weight | 486.66 g/mol |
| Exact Mass | 486.25 |
| IUPAC Name | 1-[[1-[5-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-fluorophenyl]pyrimidin-2-yl]azetidin-3-ylidene]amino]oxypentan-3-one |
| SMILES | CCC(=O)CCON=C1CN(c2ncc(-c3cccc(CO[Si](C)(C)C(C)(C)C)c3F)cn2)C1 |
| InChI | InChI=1S/C25H35FN4O3Si/c1-7-21(31)11-12-32-29-20-15-30(16-20)24-27-13-19(14-28-24)22-10-8-9-18(23(22)26)17-33-34(5,6)25(2,3)4/h8-10,13-14H,7,11-12,15-17H2,1-6H3 |
| InChIKey | KCYFDVAPWDHQIW-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 76.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.66 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|