C25H34FN5O4Si- — CID 145243036
CID 145243036 (PubChem CID 145243036) has the molecular formula C25H34FN5O4Si- and a molecular weight of 515.66 g/mol.
| Compound Name | CID 145243036 |
|---|---|
| PubChem CID | 145243036 |
| Molecular Formula | C25H34FN5O4Si- |
| Molecular Weight | 515.66 g/mol |
| Exact Mass | 515.24 |
| IUPAC Name | — |
| SMILES | COC(=O)N1CC(ON=C2CN(c3ncc(-c4cccc(CO[Si-](C)(C)C(C)(C)C)c4F)cn3)C2)C1 |
| InChI | InChI=1S/C25H34FN5O4Si/c1-25(2,3)36(5,6)34-16-17-8-7-9-21(22(17)26)18-10-27-23(28-11-18)30-12-19(13-30)29-35-20-14-31(15-20)24(32)33-4/h7-11,20H,12-16H2,1-6H3/q-1 |
| InChIKey | GYZCCCQRZCFEAJ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 89.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.66 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|