C23H26F2N4O5 — CID 175062904
[3-[6-[3-[(2,2-dimethyl-1,3-dioxan-5-yl)methoxyimino]azetidin-1-yl]-5-fluoro-3-pyridinyl]-2-fluorophenyl]methyl carbamate (PubChem CID 175062904) has the molecular formula C23H26F2N4O5 and a molecular weight of 476.48 g/mol. Its IUPAC name is [3-[6-[3-[(2,2-dimethyl-1,3-dioxan-5-yl)methoxyimino]azetidin-1-yl]-5-fluoro-3-pyridinyl]-2-fluorophenyl]methyl carbamate.
| Compound Name | [3-[6-[3-[(2,2-dimethyl-1,3-dioxan-5-yl)methoxyimino]azetidin-1-yl]-5-fluoro-3-pyridinyl]-2-fluorophenyl]methyl carbamate |
|---|---|
| PubChem CID | 175062904 |
| Molecular Formula | C23H26F2N4O5 |
| Molecular Weight | 476.48 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | [3-[6-[3-[(2,2-dimethyl-1,3-dioxan-5-yl)methoxyimino]azetidin-1-yl]-5-fluoro-3-pyridinyl]-2-fluorophenyl]methyl carbamate |
| SMILES | CC1(C)OCC(CON=C2CN(c3ncc(-c4cccc(COC(N)=O)c4F)cc3F)C2)CO1 |
| InChI | InChI=1S/C23H26F2N4O5/c1-23(2)32-10-14(11-33-23)12-34-28-17-8-29(9-17)21-19(24)6-16(7-27-21)18-5-3-4-15(20(18)25)13-31-22(26)30/h3-7,14H,8-13H2,1-2H3,(H2,26,30) |
| InChIKey | OZEULGGUOHSERJ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 108.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.48 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|