C26H27ClFN5O4 — CID 159308077
[3-[2-(1-benzoylpiperidin-4-yl)oxypyrimidin-5-yl]-2-fluorophenyl]methyl 3-amino-3-iminopropanoate;hydrochloride (PubChem CID 159308077) has the molecular formula C26H27ClFN5O4 and a molecular weight of 527.98 g/mol. Its IUPAC name is [3-[2-(1-benzoylpiperidin-4-yl)oxypyrimidin-5-yl]-2-fluorophenyl]methyl 3-amino-3-iminopropanoate;hydrochloride.
| Compound Name | [3-[2-(1-benzoylpiperidin-4-yl)oxypyrimidin-5-yl]-2-fluorophenyl]methyl 3-amino-3-iminopropanoate;hydrochloride |
|---|---|
| PubChem CID | 159308077 |
| Molecular Formula | C26H27ClFN5O4 |
| Molecular Weight | 527.98 g/mol |
| Exact Mass | 527.17 |
| IUPAC Name | [3-[2-(1-benzoylpiperidin-4-yl)oxypyrimidin-5-yl]-2-fluorophenyl]methyl 3-amino-3-iminopropanoate;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)CC(=O)OCc1cccc(-c2cnc(OC3CCN(C(=O)c4ccccc4)CC3)nc2)c1F |
| InChI | InChI=1S/C26H26FN5O4.ClH/c27-24-18(16-35-23(33)13-22(28)29)7-4-8-21(24)19-14-30-26(31-15-19)36-20-9-11-32(12-10-20)25(34)17-5-2-1-3-6-17;/h1-8,14-15,20H,9-13,16H2,(H3,28,29);1H |
| InChIKey | NYXCRRALJAYIFP-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 131.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.98 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|