C24H29FN4O2 — CID 121297203
cyclohexyl-[4-[5-[2-fluoro-3-(2-iminoethyl)phenyl]pyrimidin-2-yl]oxypiperidin-1-yl]methanone (PubChem CID 121297203) has the molecular formula C24H29FN4O2 and a molecular weight of 424.52 g/mol. Its IUPAC name is cyclohexyl-[4-[5-[2-fluoro-3-(2-iminoethyl)phenyl]pyrimidin-2-yl]oxypiperidin-1-yl]methanone.
| Compound Name | cyclohexyl-[4-[5-[2-fluoro-3-(2-iminoethyl)phenyl]pyrimidin-2-yl]oxypiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 121297203 |
| Molecular Formula | C24H29FN4O2 |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.23 |
| IUPAC Name | cyclohexyl-[4-[5-[2-fluoro-3-(2-iminoethyl)phenyl]pyrimidin-2-yl]oxypiperidin-1-yl]methanone |
| SMILES | [H]/N=C/Cc1cccc(-c2cnc(OC3CCN(C(=O)C4CCCCC4)CC3)nc2)c1F |
| InChI | InChI=1S/C24H29FN4O2/c25-22-17(9-12-26)7-4-8-21(22)19-15-27-24(28-16-19)31-20-10-13-29(14-11-20)23(30)18-5-2-1-3-6-18/h4,7-8,12,15-16,18,20,26H,1-3,5-6,9-11,13-14H2/b26-12+ |
| InChIKey | SMOKAKGUVZOHKP-RPPGKUMJSA-N |
| XLogP | 4.42 |
| TPSA | 79.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|