C19H26FN5O4 — CID 118132465
[3-[3-[(1-acetylpiperidin-4-yl)amino]-3-oxopropyl]-2-fluorophenyl]methyl N-(diaminomethylidene)carbamate (PubChem CID 118132465) has the molecular formula C19H26FN5O4 and a molecular weight of 407.45 g/mol. Its IUPAC name is [3-[3-[(1-acetylpiperidin-4-yl)amino]-3-oxopropyl]-2-fluorophenyl]methyl N-(diaminomethylidene)carbamate.
| Compound Name | [3-[3-[(1-acetylpiperidin-4-yl)amino]-3-oxopropyl]-2-fluorophenyl]methyl N-(diaminomethylidene)carbamate |
|---|---|
| PubChem CID | 118132465 |
| Molecular Formula | C19H26FN5O4 |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | [3-[3-[(1-acetylpiperidin-4-yl)amino]-3-oxopropyl]-2-fluorophenyl]methyl N-(diaminomethylidene)carbamate |
| SMILES | CC(=O)N1CCC(NC(=O)CCc2cccc(COC(=O)N=C(N)N)c2F)CC1 |
| InChI | InChI=1S/C19H26FN5O4/c1-12(26)25-9-7-15(8-10-25)23-16(27)6-5-13-3-2-4-14(17(13)20)11-29-19(28)24-18(21)22/h2-4,15H,5-11H2,1H3,(H,23,27)(H4,21,22,24,28) |
| InChIKey | YRAZLLMWDHJPSV-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 140.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|