C15H19FN2O3 — CID 110821770
methyl 4-[[2-(2-fluorophenyl)acetyl]amino]piperidine-1-carboxylate (PubChem CID 110821770) has the molecular formula C15H19FN2O3 and a molecular weight of 294.33 g/mol. Its IUPAC name is methyl 4-[[2-(2-fluorophenyl)acetyl]amino]piperidine-1-carboxylate.
| Compound Name | methyl 4-[[2-(2-fluorophenyl)acetyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 110821770 |
| Molecular Formula | C15H19FN2O3 |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | methyl 4-[[2-(2-fluorophenyl)acetyl]amino]piperidine-1-carboxylate |
| SMILES | COC(=O)N1CCC(NC(=O)Cc2ccccc2F)CC1 |
| InChI | InChI=1S/C15H19FN2O3/c1-21-15(20)18-8-6-12(7-9-18)17-14(19)10-11-4-2-3-5-13(11)16/h2-5,12H,6-10H2,1H3,(H,17,19) |
| InChIKey | NQHFNURLSFUYTP-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |