C18H24FN3O4 — CID 108946231
ethyl 4-[[3-[(2-fluorophenyl)methylamino]-3-oxopropanoyl]amino]piperidine-1-carboxylate (PubChem CID 108946231) has the molecular formula C18H24FN3O4 and a molecular weight of 365.41 g/mol. Its IUPAC name is ethyl 4-[[3-[(2-fluorophenyl)methylamino]-3-oxopropanoyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[3-[(2-fluorophenyl)methylamino]-3-oxopropanoyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 108946231 |
| Molecular Formula | C18H24FN3O4 |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | ethyl 4-[[3-[(2-fluorophenyl)methylamino]-3-oxopropanoyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)CC(=O)NCc2ccccc2F)CC1 |
| InChI | InChI=1S/C18H24FN3O4/c1-2-26-18(25)22-9-7-14(8-10-22)21-17(24)11-16(23)20-12-13-5-3-4-6-15(13)19/h3-6,14H,2,7-12H2,1H3,(H,20,23)(H,21,24) |
| InChIKey | DOLVDQDMAMGHJO-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|