C17H23FN2O3 — CID 39709187
ethyl 4-[2-(2-fluorophenyl)ethylcarbamoyl]piperidine-1-carboxylate (PubChem CID 39709187) has the molecular formula C17H23FN2O3 and a molecular weight of 322.38 g/mol. Its IUPAC name is ethyl 4-[2-(2-fluorophenyl)ethylcarbamoyl]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[2-(2-fluorophenyl)ethylcarbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 39709187 |
| Molecular Formula | C17H23FN2O3 |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | ethyl 4-[2-(2-fluorophenyl)ethylcarbamoyl]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(C(=O)NCCc2ccccc2F)CC1 |
| InChI | InChI=1S/C17H23FN2O3/c1-2-23-17(22)20-11-8-14(9-12-20)16(21)19-10-7-13-5-3-4-6-15(13)18/h3-6,14H,2,7-12H2,1H3,(H,19,21) |
| InChIKey | GPTNQJMXQKCQDS-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |