C25H31FN2O2 — CID 55778891
1-[3-(4-ethylphenyl)propanoyl]-N-[2-(2-fluorophenyl)ethyl]piperidine-4-carboxamide (PubChem CID 55778891) has the molecular formula C25H31FN2O2 and a molecular weight of 410.53 g/mol. Its IUPAC name is 1-[3-(4-ethylphenyl)propanoyl]-N-[2-(2-fluorophenyl)ethyl]piperidine-4-carboxamide.
| Compound Name | 1-[3-(4-ethylphenyl)propanoyl]-N-[2-(2-fluorophenyl)ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55778891 |
| Molecular Formula | C25H31FN2O2 |
| Molecular Weight | 410.53 g/mol |
| Exact Mass | 410.24 |
| IUPAC Name | 1-[3-(4-ethylphenyl)propanoyl]-N-[2-(2-fluorophenyl)ethyl]piperidine-4-carboxamide |
| SMILES | CCc1ccc(CCC(=O)N2CCC(C(=O)NCCc3ccccc3F)CC2)cc1 |
| InChI | InChI=1S/C25H31FN2O2/c1-2-19-7-9-20(10-8-19)11-12-24(29)28-17-14-22(15-18-28)25(30)27-16-13-21-5-3-4-6-23(21)26/h3-10,22H,2,11-18H2,1H3,(H,27,30) |
| InChIKey | XVVAXOIXKXXZPE-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.53 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |