C20H27FN2O4S — CID 56567715
methyl 2-[3-[4-[2-(2-fluorophenyl)ethylcarbamoyl]piperidin-1-yl]-3-oxopropyl]sulfanylacetate (PubChem CID 56567715) has the molecular formula C20H27FN2O4S and a molecular weight of 410.51 g/mol. Its IUPAC name is methyl 2-[3-[4-[2-(2-fluorophenyl)ethylcarbamoyl]piperidin-1-yl]-3-oxopropyl]sulfanylacetate.
| Compound Name | methyl 2-[3-[4-[2-(2-fluorophenyl)ethylcarbamoyl]piperidin-1-yl]-3-oxopropyl]sulfanylacetate |
|---|---|
| PubChem CID | 56567715 |
| Molecular Formula | C20H27FN2O4S |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | methyl 2-[3-[4-[2-(2-fluorophenyl)ethylcarbamoyl]piperidin-1-yl]-3-oxopropyl]sulfanylacetate |
| SMILES | COC(=O)CSCCC(=O)N1CCC(C(=O)NCCc2ccccc2F)CC1 |
| InChI | InChI=1S/C20H27FN2O4S/c1-27-19(25)14-28-13-9-18(24)23-11-7-16(8-12-23)20(26)22-10-6-15-4-2-3-5-17(15)21/h2-5,16H,6-14H2,1H3,(H,22,26) |
| InChIKey | DBKAUMXEUIELEZ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|