C26H30FN3O4 — CID 55779180
1-[4-(4-cyano-2-methoxyphenoxy)butanoyl]-N-[2-(2-fluorophenyl)ethyl]piperidine-4-carboxamide (PubChem CID 55779180) has the molecular formula C26H30FN3O4 and a molecular weight of 467.54 g/mol. Its IUPAC name is 1-[4-(4-cyano-2-methoxyphenoxy)butanoyl]-N-[2-(2-fluorophenyl)ethyl]piperidine-4-carboxamide.
| Compound Name | 1-[4-(4-cyano-2-methoxyphenoxy)butanoyl]-N-[2-(2-fluorophenyl)ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55779180 |
| Molecular Formula | C26H30FN3O4 |
| Molecular Weight | 467.54 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | 1-[4-(4-cyano-2-methoxyphenoxy)butanoyl]-N-[2-(2-fluorophenyl)ethyl]piperidine-4-carboxamide |
| SMILES | COc1cc(C#N)ccc1OCCCC(=O)N1CCC(C(=O)NCCc2ccccc2F)CC1 |
| InChI | InChI=1S/C26H30FN3O4/c1-33-24-17-19(18-28)8-9-23(24)34-16-4-7-25(31)30-14-11-21(12-15-30)26(32)29-13-10-20-5-2-3-6-22(20)27/h2-3,5-6,8-9,17,21H,4,7,10-16H2,1H3,(H,29,32) |
| InChIKey | ZACVQWNIKSIOAU-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 91.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.54 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|