C25H27N3O6 — CID 55719954
N-(1,3-benzodioxol-5-yl)-1-[4-(4-cyano-2-methoxyphenoxy)butanoyl]piperidine-4-carboxamide (PubChem CID 55719954) has the molecular formula C25H27N3O6 and a molecular weight of 465.51 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-1-[4-(4-cyano-2-methoxyphenoxy)butanoyl]piperidine-4-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-1-[4-(4-cyano-2-methoxyphenoxy)butanoyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55719954 |
| Molecular Formula | C25H27N3O6 |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-1-[4-(4-cyano-2-methoxyphenoxy)butanoyl]piperidine-4-carboxamide |
| SMILES | COc1cc(C#N)ccc1OCCCC(=O)N1CCC(C(=O)Nc2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C25H27N3O6/c1-31-22-13-17(15-26)4-6-20(22)32-12-2-3-24(29)28-10-8-18(9-11-28)25(30)27-19-5-7-21-23(14-19)34-16-33-21/h4-7,13-14,18H,2-3,8-12,16H2,1H3,(H,27,30) |
| InChIKey | KWHWGYPFFIAHEV-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 110.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|