C23H23Cl2N3O4 — CID 55718497
4-[4-[4-(3,5-dichlorobenzoyl)piperazin-1-yl]-4-oxobutoxy]-3-methoxybenzonitrile (PubChem CID 55718497) has the molecular formula C23H23Cl2N3O4 and a molecular weight of 476.36 g/mol. Its IUPAC name is 4-[4-[4-(3,5-dichlorobenzoyl)piperazin-1-yl]-4-oxobutoxy]-3-methoxybenzonitrile.
| Compound Name | 4-[4-[4-(3,5-dichlorobenzoyl)piperazin-1-yl]-4-oxobutoxy]-3-methoxybenzonitrile |
|---|---|
| PubChem CID | 55718497 |
| Molecular Formula | C23H23Cl2N3O4 |
| Molecular Weight | 476.36 g/mol |
| Exact Mass | 475.11 |
| IUPAC Name | 4-[4-[4-(3,5-dichlorobenzoyl)piperazin-1-yl]-4-oxobutoxy]-3-methoxybenzonitrile |
| SMILES | COc1cc(C#N)ccc1OCCCC(=O)N1CCN(C(=O)c2cc(Cl)cc(Cl)c2)CC1 |
| InChI | InChI=1S/C23H23Cl2N3O4/c1-31-21-11-16(15-26)4-5-20(21)32-10-2-3-22(29)27-6-8-28(9-7-27)23(30)17-12-18(24)14-19(25)13-17/h4-5,11-14H,2-3,6-10H2,1H3 |
| InChIKey | WARGWBMHBYXRGG-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 82.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.36 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|