C23H23N3O3 — CID 55719300
3-methoxy-4-[4-oxo-4-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)butoxy]benzonitrile (PubChem CID 55719300) has the molecular formula C23H23N3O3 and a molecular weight of 389.46 g/mol. Its IUPAC name is 3-methoxy-4-[4-oxo-4-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)butoxy]benzonitrile.
| Compound Name | 3-methoxy-4-[4-oxo-4-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)butoxy]benzonitrile |
|---|---|
| PubChem CID | 55719300 |
| Molecular Formula | C23H23N3O3 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | 3-methoxy-4-[4-oxo-4-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)butoxy]benzonitrile |
| SMILES | COc1cc(C#N)ccc1OCCCC(=O)N1CCc2[nH]c3ccccc3c2C1 |
| InChI | InChI=1S/C23H23N3O3/c1-28-22-13-16(14-24)8-9-21(22)29-12-4-7-23(27)26-11-10-20-18(15-26)17-5-2-3-6-19(17)25-20/h2-3,5-6,8-9,13,25H,4,7,10-12,15H2,1H3 |
| InChIKey | MOOMJDGMVPVYAH-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|