C20H23N3O3 — CID 55718459
3-methoxy-4-[4-(1-methyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-4-oxobutoxy]benzonitrile (PubChem CID 55718459) has the molecular formula C20H23N3O3 and a molecular weight of 353.42 g/mol. Its IUPAC name is 3-methoxy-4-[4-(1-methyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-4-oxobutoxy]benzonitrile.
| Compound Name | 3-methoxy-4-[4-(1-methyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-4-oxobutoxy]benzonitrile |
|---|---|
| PubChem CID | 55718459 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | 3-methoxy-4-[4-(1-methyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-4-oxobutoxy]benzonitrile |
| SMILES | COc1cc(C#N)ccc1OCCCC(=O)N1CCn2cccc2C1C |
| InChI | InChI=1S/C20H23N3O3/c1-15-17-5-3-9-22(17)10-11-23(15)20(24)6-4-12-26-18-8-7-16(14-21)13-19(18)25-2/h3,5,7-9,13,15H,4,6,10-12H2,1-2H3 |
| InChIKey | BVXJSCIVSNHMQB-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 67.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|