C18H25FN2O2S — CID 55778984
N-[2-(2-fluorophenyl)ethyl]-1-(3-methylsulfanylpropanoyl)piperidine-4-carboxamide (PubChem CID 55778984) has the molecular formula C18H25FN2O2S and a molecular weight of 352.48 g/mol. Its IUPAC name is N-[2-(2-fluorophenyl)ethyl]-1-(3-methylsulfanylpropanoyl)piperidine-4-carboxamide.
| Compound Name | N-[2-(2-fluorophenyl)ethyl]-1-(3-methylsulfanylpropanoyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55778984 |
| Molecular Formula | C18H25FN2O2S |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | N-[2-(2-fluorophenyl)ethyl]-1-(3-methylsulfanylpropanoyl)piperidine-4-carboxamide |
| SMILES | CSCCC(=O)N1CCC(C(=O)NCCc2ccccc2F)CC1 |
| InChI | InChI=1S/C18H25FN2O2S/c1-24-13-9-17(22)21-11-7-15(8-12-21)18(23)20-10-6-14-4-2-3-5-16(14)19/h2-5,15H,6-13H2,1H3,(H,20,23) |
| InChIKey | YORCWJBGBPLHKZ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |