C20H28FN3O3 — CID 55738783
N-[2-(2-fluorophenyl)ethyl]-1-(2-morpholin-4-yl-2-oxoethyl)piperidine-4-carboxamide (PubChem CID 55738783) has the molecular formula C20H28FN3O3 and a molecular weight of 377.46 g/mol. Its IUPAC name is N-[2-(2-fluorophenyl)ethyl]-1-(2-morpholin-4-yl-2-oxoethyl)piperidine-4-carboxamide.
| Compound Name | N-[2-(2-fluorophenyl)ethyl]-1-(2-morpholin-4-yl-2-oxoethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55738783 |
| Molecular Formula | C20H28FN3O3 |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | N-[2-(2-fluorophenyl)ethyl]-1-(2-morpholin-4-yl-2-oxoethyl)piperidine-4-carboxamide |
| SMILES | O=C(NCCc1ccccc1F)C1CCN(CC(=O)N2CCOCC2)CC1 |
| InChI | InChI=1S/C20H28FN3O3/c21-18-4-2-1-3-16(18)5-8-22-20(26)17-6-9-23(10-7-17)15-19(25)24-11-13-27-14-12-24/h1-4,17H,5-15H2,(H,22,26) |
| InChIKey | QRVNVXQDPMXGIU-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |