C16H19F2N3O4 — CID 108522111
ethyl 4-[[2-(2,6-difluoroanilino)-2-oxoacetyl]amino]piperidine-1-carboxylate (PubChem CID 108522111) has the molecular formula C16H19F2N3O4 and a molecular weight of 355.34 g/mol. Its IUPAC name is ethyl 4-[[2-(2,6-difluoroanilino)-2-oxoacetyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[2-(2,6-difluoroanilino)-2-oxoacetyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 108522111 |
| Molecular Formula | C16H19F2N3O4 |
| Molecular Weight | 355.34 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | ethyl 4-[[2-(2,6-difluoroanilino)-2-oxoacetyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)C(=O)Nc2c(F)cccc2F)CC1 |
| InChI | InChI=1S/C16H19F2N3O4/c1-2-25-16(24)21-8-6-10(7-9-21)19-14(22)15(23)20-13-11(17)4-3-5-12(13)18/h3-5,10H,2,6-9H2,1H3,(H,19,22)(H,20,23) |
| InChIKey | FNHZJHPYTPUURK-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.34 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|