C17H22BrN3O4 — CID 108531772
ethyl 4-[[2-(2-bromo-4-methylanilino)-2-oxoacetyl]amino]piperidine-1-carboxylate (PubChem CID 108531772) has the molecular formula C17H22BrN3O4 and a molecular weight of 412.28 g/mol. Its IUPAC name is ethyl 4-[[2-(2-bromo-4-methylanilino)-2-oxoacetyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[2-(2-bromo-4-methylanilino)-2-oxoacetyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 108531772 |
| Molecular Formula | C17H22BrN3O4 |
| Molecular Weight | 412.28 g/mol |
| Exact Mass | 411.08 |
| IUPAC Name | ethyl 4-[[2-(2-bromo-4-methylanilino)-2-oxoacetyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)C(=O)Nc2ccc(C)cc2Br)CC1 |
| InChI | InChI=1S/C17H22BrN3O4/c1-3-25-17(24)21-8-6-12(7-9-21)19-15(22)16(23)20-14-5-4-11(2)10-13(14)18/h4-5,10,12H,3,6-9H2,1-2H3,(H,19,22)(H,20,23) |
| InChIKey | YJIIFYWEQYHOIR-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.28 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|