C15H23BrClN3O — CID 119923517
N-(2-bromo-4-methylphenyl)-2-[4-(methylamino)piperidin-1-yl]acetamide;hydrochloride (PubChem CID 119923517) has the molecular formula C15H23BrClN3O and a molecular weight of 376.73 g/mol. Its IUPAC name is N-(2-bromo-4-methylphenyl)-2-[4-(methylamino)piperidin-1-yl]acetamide;hydrochloride.
| Compound Name | N-(2-bromo-4-methylphenyl)-2-[4-(methylamino)piperidin-1-yl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 119923517 |
| Molecular Formula | C15H23BrClN3O |
| Molecular Weight | 376.73 g/mol |
| Exact Mass | 375.07 |
| IUPAC Name | N-(2-bromo-4-methylphenyl)-2-[4-(methylamino)piperidin-1-yl]acetamide;hydrochloride |
| SMILES | CNC1CCN(CC(=O)Nc2ccc(C)cc2Br)CC1.Cl |
| InChI | InChI=1S/C15H22BrN3O.ClH/c1-11-3-4-14(13(16)9-11)18-15(20)10-19-7-5-12(17-2)6-8-19;/h3-4,9,12,17H,5-8,10H2,1-2H3,(H,18,20);1H |
| InChIKey | NCXYTIRCVXFETM-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.73 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |