C21H26BrN3O — CID 9266537
N-(2-bromo-4-methylphenyl)-2-[4-[(3-methylphenyl)methyl]piperazin-1-yl]acetamide (PubChem CID 9266537) has the molecular formula C21H26BrN3O and a molecular weight of 416.36 g/mol. Its IUPAC name is N-(2-bromo-4-methylphenyl)-2-[4-[(3-methylphenyl)methyl]piperazin-1-yl]acetamide.
| Compound Name | N-(2-bromo-4-methylphenyl)-2-[4-[(3-methylphenyl)methyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 9266537 |
| Molecular Formula | C21H26BrN3O |
| Molecular Weight | 416.36 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | N-(2-bromo-4-methylphenyl)-2-[4-[(3-methylphenyl)methyl]piperazin-1-yl]acetamide |
| SMILES | Cc1cccc(CN2CCN(CC(=O)Nc3ccc(C)cc3Br)CC2)c1 |
| InChI | InChI=1S/C21H26BrN3O/c1-16-4-3-5-18(12-16)14-24-8-10-25(11-9-24)15-21(26)23-20-7-6-17(2)13-19(20)22/h3-7,12-13H,8-11,14-15H2,1-2H3,(H,23,26) |
| InChIKey | JDGZKQLWDYYOPG-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.36 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |