C19H21BrClN3O3S — CID 27185823
N-(2-bromo-4-methylphenyl)-2-[4-(3-chlorophenyl)sulfonylpiperazin-1-yl]acetamide (PubChem CID 27185823) has the molecular formula C19H21BrClN3O3S and a molecular weight of 486.82 g/mol. Its IUPAC name is N-(2-bromo-4-methylphenyl)-2-[4-(3-chlorophenyl)sulfonylpiperazin-1-yl]acetamide.
| Compound Name | N-(2-bromo-4-methylphenyl)-2-[4-(3-chlorophenyl)sulfonylpiperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 27185823 |
| Molecular Formula | C19H21BrClN3O3S |
| Molecular Weight | 486.82 g/mol |
| Exact Mass | 485.02 |
| IUPAC Name | N-(2-bromo-4-methylphenyl)-2-[4-(3-chlorophenyl)sulfonylpiperazin-1-yl]acetamide |
| SMILES | Cc1ccc(NC(=O)CN2CCN(S(=O)(=O)c3cccc(Cl)c3)CC2)c(Br)c1 |
| InChI | InChI=1S/C19H21BrClN3O3S/c1-14-5-6-18(17(20)11-14)22-19(25)13-23-7-9-24(10-8-23)28(26,27)16-4-2-3-15(21)12-16/h2-6,11-12H,7-10,13H2,1H3,(H,22,25) |
| InChIKey | ITGOKUIIPYHQQR-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.82 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |