C14H20BrN3O — CID 104975690
N-(2-bromo-4-methylphenyl)-2-[(3R)-3-methylpiperazin-1-yl]acetamide (PubChem CID 104975690) has the molecular formula C14H20BrN3O and a molecular weight of 326.24 g/mol. Its IUPAC name is N-(2-bromo-4-methylphenyl)-2-[(3R)-3-methylpiperazin-1-yl]acetamide.
| Compound Name | N-(2-bromo-4-methylphenyl)-2-[(3R)-3-methylpiperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 104975690 |
| Molecular Formula | C14H20BrN3O |
| Molecular Weight | 326.24 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | N-(2-bromo-4-methylphenyl)-2-[(3R)-3-methylpiperazin-1-yl]acetamide |
| SMILES | Cc1ccc(NC(=O)CN2CCN[C@H](C)C2)c(Br)c1 |
| InChI | InChI=1S/C14H20BrN3O/c1-10-3-4-13(12(15)7-10)17-14(19)9-18-6-5-16-11(2)8-18/h3-4,7,11,16H,5-6,8-9H2,1-2H3,(H,17,19)/t11-/m1/s1 |
| InChIKey | KKMOBEVBTGIPJR-LLVKDONJSA-N |
| XLogP | 1.99 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.24 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |