C18H25F2IN4O2 — CID 111815321
ethyl 4-[[N'-[2-(2,6-difluorophenyl)cyclopropyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide (PubChem CID 111815321) has the molecular formula C18H25F2IN4O2 and a molecular weight of 494.32 g/mol. Its IUPAC name is ethyl 4-[[N'-[2-(2,6-difluorophenyl)cyclopropyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide.
| Compound Name | ethyl 4-[[N'-[2-(2,6-difluorophenyl)cyclopropyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111815321 |
| Molecular Formula | C18H25F2IN4O2 |
| Molecular Weight | 494.32 g/mol |
| Exact Mass | 494.10 |
| IUPAC Name | ethyl 4-[[N'-[2-(2,6-difluorophenyl)cyclopropyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
| SMILES | CCOC(=O)N1CCC(N/C(N)=N/C2CC2c2c(F)cccc2F)CC1.I |
| InChI | InChI=1S/C18H24F2N4O2.HI/c1-2-26-18(25)24-8-6-11(7-9-24)22-17(21)23-15-10-12(15)16-13(19)4-3-5-14(16)20;/h3-5,11-12,15H,2,6-10H2,1H3,(H3,21,22,23);1H |
| InChIKey | KCNQZWSKXRRELH-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 79.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.32 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|