C22H26F2N4 — CID 120671276
1-(1-benzylpiperidin-4-yl)-2-[(1R,2S)-2-(2,6-difluorophenyl)cyclopropyl]guanidine (PubChem CID 120671276) has the molecular formula C22H26F2N4 and a molecular weight of 384.47 g/mol. Its IUPAC name is 1-(1-benzylpiperidin-4-yl)-2-[(1R,2S)-2-(2,6-difluorophenyl)cyclopropyl]guanidine.
| Compound Name | 1-(1-benzylpiperidin-4-yl)-2-[(1R,2S)-2-(2,6-difluorophenyl)cyclopropyl]guanidine |
|---|---|
| PubChem CID | 120671276 |
| Molecular Formula | C22H26F2N4 |
| Molecular Weight | 384.47 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | 1-(1-benzylpiperidin-4-yl)-2-[(1R,2S)-2-(2,6-difluorophenyl)cyclopropyl]guanidine |
| SMILES | N/C(=N\[C@@H]1C[C@H]1c1c(F)cccc1F)NC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C22H26F2N4/c23-18-7-4-8-19(24)21(18)17-13-20(17)27-22(25)26-16-9-11-28(12-10-16)14-15-5-2-1-3-6-15/h1-8,16-17,20H,9-14H2,(H3,25,26,27)/t17-,20-/m1/s1 |
| InChIKey | FDUMYVDOWMAPJN-YLJYHZDGSA-N |
| XLogP | 3.39 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.47 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|