C16H20Cl2N2O — CID 24654457
N-(1-benzylpiperidin-4-yl)-2,2-dichlorocyclopropane-1-carboxamide (PubChem CID 24654457) has the molecular formula C16H20Cl2N2O and a molecular weight of 327.25 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-2,2-dichlorocyclopropane-1-carboxamide.
| Compound Name | N-(1-benzylpiperidin-4-yl)-2,2-dichlorocyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 24654457 |
| Molecular Formula | C16H20Cl2N2O |
| Molecular Weight | 327.25 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-2,2-dichlorocyclopropane-1-carboxamide |
| SMILES | O=C(NC1CCN(Cc2ccccc2)CC1)C1CC1(Cl)Cl |
| InChI | InChI=1S/C16H20Cl2N2O/c17-16(18)10-14(16)15(21)19-13-6-8-20(9-7-13)11-12-4-2-1-3-5-12/h1-5,13-14H,6-11H2,(H,19,21) |
| InChIKey | ROAKOJPZCODBQM-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.25 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|