C17H22Cl2N2O — CID 136579148
N-[(1-benzylpiperidin-4-yl)methyl]-2,2-dichlorocyclopropane-1-carboxamide (PubChem CID 136579148) has the molecular formula C17H22Cl2N2O and a molecular weight of 341.28 g/mol. Its IUPAC name is N-[(1-benzylpiperidin-4-yl)methyl]-2,2-dichlorocyclopropane-1-carboxamide.
| Compound Name | N-[(1-benzylpiperidin-4-yl)methyl]-2,2-dichlorocyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 136579148 |
| Molecular Formula | C17H22Cl2N2O |
| Molecular Weight | 341.28 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | N-[(1-benzylpiperidin-4-yl)methyl]-2,2-dichlorocyclopropane-1-carboxamide |
| SMILES | O=C(NCC1CCN(Cc2ccccc2)CC1)C1CC1(Cl)Cl |
| InChI | InChI=1S/C17H22Cl2N2O/c18-17(19)10-15(17)16(22)20-11-13-6-8-21(9-7-13)12-14-4-2-1-3-5-14/h1-5,13,15H,6-12H2,(H,20,22) |
| InChIKey | PSHXJVPUEHVHNA-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.28 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|