C24H31N7O10 — CID 86686257
(2R,3R)-2,3-dihydroxybutanedioic acid;[3-[2-[4-(2-methoxyacetyl)piperazin-1-yl]pyrimidin-5-yl]phenyl]methyl N-(diaminomethylidene)carbamate (PubChem CID 86686257) has the molecular formula C24H31N7O10 and a molecular weight of 577.55 g/mol. Its IUPAC name is (2R,3R)-2,3-dihydroxybutanedioic acid;[3-[2-[4-(2-methoxyacetyl)piperazin-1-yl]pyrimidin-5-yl]phenyl]methyl N-(diaminomethylidene)carbamate.
| Compound Name | (2R,3R)-2,3-dihydroxybutanedioic acid;[3-[2-[4-(2-methoxyacetyl)piperazin-1-yl]pyrimidin-5-yl]phenyl]methyl N-(diaminomethylidene)carbamate |
|---|---|
| PubChem CID | 86686257 |
| Molecular Formula | C24H31N7O10 |
| Molecular Weight | 577.55 g/mol |
| Exact Mass | 577.21 |
| IUPAC Name | (2R,3R)-2,3-dihydroxybutanedioic acid;[3-[2-[4-(2-methoxyacetyl)piperazin-1-yl]pyrimidin-5-yl]phenyl]methyl N-(diaminomethylidene)carbamate |
| SMILES | COCC(=O)N1CCN(c2ncc(-c3cccc(COC(=O)N=C(N)N)c3)cn2)CC1.O=C(O)[C@H](O)[C@@H](O)C(=O)O |
| InChI | InChI=1S/C20H25N7O4.C4H6O6/c1-30-13-17(28)26-5-7-27(8-6-26)19-23-10-16(11-24-19)15-4-2-3-14(9-15)12-31-20(29)25-18(21)22;5-1(3(7)8)2(6)4(9)10/h2-4,9-11H,5-8,12-13H2,1H3,(H4,21,22,25,29);1-2,5-6H,(H,7,8)(H,9,10)/t;1-,2-/m.1/s1 |
| InChIKey | IMOQJJZZMLNCBV-LREBCSMRSA-N |
| XLogP | -1.77 |
| TPSA | 264.32 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.55 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|