C19H26N8O2 — CID 118132405
1-(diaminomethylidene)-3-[[3-[2-[4-(2-hydroxyethyl)piperazin-1-yl]pyrimidin-5-yl]phenyl]methyl]urea (PubChem CID 118132405) has the molecular formula C19H26N8O2 and a molecular weight of 398.47 g/mol. Its IUPAC name is 1-(diaminomethylidene)-3-[[3-[2-[4-(2-hydroxyethyl)piperazin-1-yl]pyrimidin-5-yl]phenyl]methyl]urea.
| Compound Name | 1-(diaminomethylidene)-3-[[3-[2-[4-(2-hydroxyethyl)piperazin-1-yl]pyrimidin-5-yl]phenyl]methyl]urea |
|---|---|
| PubChem CID | 118132405 |
| Molecular Formula | C19H26N8O2 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | 1-(diaminomethylidene)-3-[[3-[2-[4-(2-hydroxyethyl)piperazin-1-yl]pyrimidin-5-yl]phenyl]methyl]urea |
| SMILES | NC(N)=NC(=O)NCc1cccc(-c2cnc(N3CCN(CCO)CC3)nc2)c1 |
| InChI | InChI=1S/C19H26N8O2/c20-17(21)25-19(29)24-11-14-2-1-3-15(10-14)16-12-22-18(23-13-16)27-6-4-26(5-7-27)8-9-28/h1-3,10,12-13,28H,4-9,11H2,(H5,20,21,24,25,29) |
| InChIKey | PPNYSFHMEUVLBX-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 145.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|