C25H27N5O3S — CID 147693887
5-[3-[2-[3-(benzenesulfonyl)pyrrolidin-1-yl]pyrimidin-5-yl]phenyl]-3-oxopentanimidamide (PubChem CID 147693887) has the molecular formula C25H27N5O3S and a molecular weight of 477.59 g/mol. Its IUPAC name is 5-[3-[2-[3-(benzenesulfonyl)pyrrolidin-1-yl]pyrimidin-5-yl]phenyl]-3-oxopentanimidamide.
| Compound Name | 5-[3-[2-[3-(benzenesulfonyl)pyrrolidin-1-yl]pyrimidin-5-yl]phenyl]-3-oxopentanimidamide |
|---|---|
| PubChem CID | 147693887 |
| Molecular Formula | C25H27N5O3S |
| Molecular Weight | 477.59 g/mol |
| Exact Mass | 477.18 |
| IUPAC Name | 5-[3-[2-[3-(benzenesulfonyl)pyrrolidin-1-yl]pyrimidin-5-yl]phenyl]-3-oxopentanimidamide |
| SMILES | [H]/N=C(\N)CC(=O)CCc1cccc(-c2cnc(N3CCC(S(=O)(=O)c4ccccc4)C3)nc2)c1 |
| InChI | InChI=1S/C25H27N5O3S/c26-24(27)14-21(31)10-9-18-5-4-6-19(13-18)20-15-28-25(29-16-20)30-12-11-23(17-30)34(32,33)22-7-2-1-3-8-22/h1-8,13,15-16,23H,9-12,14,17H2,(H3,26,27) |
| InChIKey | GRMRUSDROHBCPL-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 130.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.59 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|