C18H23N5O2 — CID 147606694
5-[3-[2-[2-hydroxyethyl(methyl)amino]pyrimidin-5-yl]phenyl]-3-oxopentanimidamide (PubChem CID 147606694) has the molecular formula C18H23N5O2 and a molecular weight of 341.42 g/mol. Its IUPAC name is 5-[3-[2-[2-hydroxyethyl(methyl)amino]pyrimidin-5-yl]phenyl]-3-oxopentanimidamide.
| Compound Name | 5-[3-[2-[2-hydroxyethyl(methyl)amino]pyrimidin-5-yl]phenyl]-3-oxopentanimidamide |
|---|---|
| PubChem CID | 147606694 |
| Molecular Formula | C18H23N5O2 |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 5-[3-[2-[2-hydroxyethyl(methyl)amino]pyrimidin-5-yl]phenyl]-3-oxopentanimidamide |
| SMILES | [H]/N=C(\N)CC(=O)CCc1cccc(-c2cnc(N(C)CCO)nc2)c1 |
| InChI | InChI=1S/C18H23N5O2/c1-23(7-8-24)18-21-11-15(12-22-18)14-4-2-3-13(9-14)5-6-16(25)10-17(19)20/h2-4,9,11-12,24H,5-8,10H2,1H3,(H3,19,20) |
| InChIKey | GBEXADMUPHZNMG-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 116.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|