C24H26N6O3 — CID 148605981
5-[3-[2-[4-(furan-2-carbonyl)piperazin-1-yl]pyrimidin-5-yl]phenyl]-3-oxopentanimidamide (PubChem CID 148605981) has the molecular formula C24H26N6O3 and a molecular weight of 446.51 g/mol. Its IUPAC name is 5-[3-[2-[4-(furan-2-carbonyl)piperazin-1-yl]pyrimidin-5-yl]phenyl]-3-oxopentanimidamide.
| Compound Name | 5-[3-[2-[4-(furan-2-carbonyl)piperazin-1-yl]pyrimidin-5-yl]phenyl]-3-oxopentanimidamide |
|---|---|
| PubChem CID | 148605981 |
| Molecular Formula | C24H26N6O3 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | 5-[3-[2-[4-(furan-2-carbonyl)piperazin-1-yl]pyrimidin-5-yl]phenyl]-3-oxopentanimidamide |
| SMILES | [H]/N=C(\N)CC(=O)CCc1cccc(-c2cnc(N3CCN(C(=O)c4ccco4)CC3)nc2)c1 |
| InChI | InChI=1S/C24H26N6O3/c25-22(26)14-20(31)7-6-17-3-1-4-18(13-17)19-15-27-24(28-16-19)30-10-8-29(9-11-30)23(32)21-5-2-12-33-21/h1-5,12-13,15-16H,6-11,14H2,(H3,25,26) |
| InChIKey | NDKKCUJIAQBKOU-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 129.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|