C10H16N4O6S — CID 75539457
4-(furan-2-carbonyl)piperazine-1-carboximidamide;sulfuric acid (PubChem CID 75539457) has the molecular formula C10H16N4O6S and a molecular weight of 320.33 g/mol. Its IUPAC name is 4-(furan-2-carbonyl)piperazine-1-carboximidamide;sulfuric acid.
| Compound Name | 4-(furan-2-carbonyl)piperazine-1-carboximidamide;sulfuric acid |
|---|---|
| PubChem CID | 75539457 |
| Molecular Formula | C10H16N4O6S |
| Molecular Weight | 320.33 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 4-(furan-2-carbonyl)piperazine-1-carboximidamide;sulfuric acid |
| SMILES | O=S(=O)(O)O.[H]/N=C(\N)N1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C10H14N4O2.H2O4S/c11-10(12)14-5-3-13(4-6-14)9(15)8-2-1-7-16-8;1-5(2,3)4/h1-2,7H,3-6H2,(H3,11,12);(H2,1,2,3,4) |
| InChIKey | NARRLHLTVVEFSY-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 161.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.33 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|