C12H16N2NaO6S2+ — CID 126465640
sodium 1-(furan-2-carbonyl)-4-(3-sulfosulfanylpropanoyl)piperazine (PubChem CID 126465640) has the molecular formula C12H16N2NaO6S2+ and a molecular weight of 371.39 g/mol. Its IUPAC name is sodium 1-(furan-2-carbonyl)-4-(3-sulfosulfanylpropanoyl)piperazine.
| Compound Name | sodium 1-(furan-2-carbonyl)-4-(3-sulfosulfanylpropanoyl)piperazine |
|---|---|
| PubChem CID | 126465640 |
| Molecular Formula | C12H16N2NaO6S2+ |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.03 |
| IUPAC Name | sodium 1-(furan-2-carbonyl)-4-(3-sulfosulfanylpropanoyl)piperazine |
| SMILES | O=C(CCSS(=O)(=O)O)N1CCN(C(=O)c2ccco2)CC1.[Na+] |
| InChI | InChI=1S/C12H16N2O6S2.Na/c15-11(3-9-21-22(17,18)19)13-4-6-14(7-5-13)12(16)10-2-1-8-20-10;/h1-2,8H,3-7,9H2,(H,17,18,19);/q;+1 |
| InChIKey | MMPUFUHDZPXOHK-UHFFFAOYSA-N |
| XLogP | -2.51 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | -2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|