C14H21N3O4S — CID 5298740
furan-2-yl-(4-piperidin-1-ylsulfonylpiperazin-1-yl)methanone (PubChem CID 5298740) has the molecular formula C14H21N3O4S and a molecular weight of 327.41 g/mol. Its IUPAC name is furan-2-yl-(4-piperidin-1-ylsulfonylpiperazin-1-yl)methanone.
| Compound Name | furan-2-yl-(4-piperidin-1-ylsulfonylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 5298740 |
| Molecular Formula | C14H21N3O4S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | furan-2-yl-(4-piperidin-1-ylsulfonylpiperazin-1-yl)methanone |
| SMILES | O=C(c1ccco1)N1CCN(S(=O)(=O)N2CCCCC2)CC1 |
| InChI | InChI=1S/C14H21N3O4S/c18-14(13-5-4-12-21-13)15-8-10-17(11-9-15)22(19,20)16-6-2-1-3-7-16/h4-5,12H,1-3,6-11H2 |
| InChIKey | PHDMNRHYAYLXFR-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 74.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |